CAS
98968-77-5 Purity
96%
98968-77-5 Purity
96%
![Cycloprop[a]indene-1-carbonyl chloride,1,1a,6,6a-tetrahydro-,(1alpha,1aalpha,6aalpha)-(9ci)](https://resource.alfa-chemistry.com/structure/98973-70-7.gif)
Inquiry Basket
Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride,3,6-dimethyl-,(1alpha,6alpha,7beta)-(9ci)
CAS
98973-72-9
Catalog Number
ACM98973729
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride,3,6-dimethyl-, (1alpha,6alpha,7beta)-(9ci)?
The molecular formula is C10H13ClO.
When was the PubChem CID 179159 created?
It was created on 2005-08-09.
What is the IUPAC name of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride?
The IUPAC name is (1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride.
What is the Canonical SMILES representation of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride?
The Canonical SMILES is CC1=CC2C(C2(CC1)C)C(=O)Cl.
How many hydrogen bond acceptor count does Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride have?
It has 1 hydrogen bond acceptor count.
What is the exact mass of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride?
The exact mass is 184.0654927 g/mol.
Is Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride a canonicalized compound?
Yes, the compound is canonicalized.
What is the XLogP3-AA value of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride?
The XLogP3-AA value is 2.6.
How many defined atom stereocenter counts does Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride have?
It has 3 defined atom stereocenter counts.
What is the topological polar surface area of Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride?
The topological polar surface area is 17.1 Ų.
Recommended Products
![2-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-oxy}aniline](https://resource.alfa-chemistry.com/structure/98968-77-5.gif)
CAS
98974-90-4 Purity
---
98974-90-4 Purity
---
