98932-70-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H9BrO4.
The compound was created on 2005-09-14 and last modified on 2023-12-30.
The IUPAC name of the compound is 2-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid.
The InChIKey of the compound is RAWVTZMLRYXFNQ-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1COC2=C(O1)C=C(C(=C2)Br)CC(=O)O.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 55.8 2.
The compound has 2 rotatable bond counts.
Yes, the compound is canonicalized.
The molecular weight of the compound is 273.08 g/mol.