What is the molecular formula of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The molecular formula is C9H7N5.
What is the molecular weight of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The molecular weight is 185.19 g/mol.
What is the IUPAC name of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The IUPAC name is 4-(1,2,4-triazol-4-yl)-1H-benzimidazole.
What is the InChI of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The InChI is InChI=1S/C9H7N5/c1-2-7-9(11-4-10-7)8(3-1)14-5-12-13-6-14/h1-6H,(H,10,11).
What is the InChIKey of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The InChIKey is FZTPAILXVRFGNS-UHFFFAOYSA-N.
What is the canonical SMILES of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The canonical SMILES is C1=CC2=C(C(=C1)N3C=NN=C3)N=CN2.
How many hydrogen bond donor counts does 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI) have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The topological polar surface area is 59.4 Ų.
Is 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI) a canonicalized compound?
Yes, it is a canonicalized compound.
What is the formal charge of 1H-Benzimidazole,4-(4H-1,2,4-triazol-4-yl)-(9CI)?
The formal charge is 0.