What is the molecular formula of (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The molecular formula is C10H18O5S.
What is the molecular weight of (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The molecular weight is 250.31 g/mol.
What are some synonyms for (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
Some synonyms include 98673-87-1, (1S)-(+)-camphor-10-sulfonic acid 1-hydrate, and (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid hydrate.
What is the IUPAC name of (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The IUPAC name is [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate.
What is the Canonical SMILES for (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The Canonical SMILES is CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C.O.
How many hydrogen bond donor count does (1S)-(+)-Camphor-10-sulfonic acid monohydrate have?
It has 2 hydrogen bond donors.
What is the heavy atom count in (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The heavy atom count is 16.
What is the topological polar surface area of (1S)-(+)-Camphor-10-sulfonic acid monohydrate?
The topological polar surface area is 80.8 Ų.
Does (1S)-(+)-Camphor-10-sulfonic acid monohydrate have any defined atom stereocenter count?
Yes, it has 2 defined atom stereocenter counts.
Is (1S)-(+)-Camphor-10-sulfonic acid monohydrate a Canonicalized compound?
Yes, it is a canonicalized compound.