98402-07-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12BrClN4O2.
The compound was created on 2005-07-19 and last modified on 2023-12-30.
The IUPAC Name of the compound is 8-bromo-7-(3-chloropropyl)-1,3-dimethylpurine-2,6-dione.
The InChIKey of the compound is GVVOAVOHACRAIB-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)Br)CCCCl.
The molecular weight of the compound is 335.58 g/mol.
The compound has 3 hydrogen bond acceptors.
The topological polar surface area of the compound is 58.4 Ų.
The compound has 3 rotatable bonds.
Yes, the compound is canonicalized.