98395-76-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is tert-butyl N-pyridin-4-ylcarbamate.
The molecular formula of the compound is C10H14N2O2.
The molecular weight of the compound is 194.23 g/mol.
The InChI of the compound is InChI=1S/C10H14N2O2/c1-10(2,3)14-9(13)12-8-4-6-11-7-5-8/h4-7H,1-3H3,(H,11,12,13).
The InChIKey of the compound is DRZYCRFOGWMEES-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C)OC(=O)NC1=CC=NC=C1.
The CAS number of the compound is 98400-69-2.
The European Community (EC) number of the compound is 628-172-8.
The DSSTox Substance ID of the compound is DTXSID20433755.
The topological polar surface area of the compound is 51.2 ?2.