What is the molecular formula of trans-bis(4-(dimethylamino)benzylidene)acetone?
The molecular formula is C21H24N2O.
What is the molecular weight of trans-bis(4-(dimethylamino)benzylidene)acetone?
The molecular weight is 320.4 g/mol.
What is the IUPAC name of trans-bis(4-(dimethylamino)benzylidene)acetone?
The IUPAC name is (1E,4E)-1,5-bis[4-(dimethylamino)phenyl]penta-1,4-dien-3-one.
What is the InChI of trans-bis(4-(dimethylamino)benzylidene)acetone?
The InChI is InChI=1S/C21H24N2O/c1-22(2)19-11-5-17(6-12-19)9-15-21(24)16-10-18-7-13-20(14-8-18)23(3)4/h5-16H,1-4H3/b15-9+,16-10+.
What is the InChIKey of trans-bis(4-(dimethylamino)benzylidene)acetone?
The InChIKey is JWTSVUUPJIIXTO-KAVGSWPWSA-N.
What is the canonical SMILES of trans-bis(4-(dimethylamino)benzylidene)acetone?
The canonical SMILES is CN(C)C1=CC=C(C=C1)C=CC(=O)C=CC2=CC=C(C=C2)N(C)C.
What is the CAS number of trans-bis(4-(dimethylamino)benzylidene)acetone?
The CAS number is 6673-14-9.
What is the EC number of trans-bis(4-(dimethylamino)benzylidene)acetone?
The EC number is 633-690-2.
What is the XLogP3-AA value of trans-bis(4-(dimethylamino)benzylidene)acetone?
The XLogP3-AA value is 4.4.
How many rotatable bonds does trans-bis(4-(dimethylamino)benzylidene)acetone have?
It has 6 rotatable bonds.