What is the molecular formula of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The molecular formula is C5H10N2OS.
What is the molecular weight of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The molecular weight is 146.21 g/mol.
What is the IUPAC name of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The IUPAC name is (4R,5R)-5-methyl-1,3-thiazolidine-4-carboxamide.
What is the InChI of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The InChI is InChI=1S/C5H10N2OS/c1-3-4(5(6)8)7-2-9-3/h3-4,7H,2H2,1H3,(H2,6,8)/t3-,4+/m1/s1.
What is the InChIKey of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The InChIKey is DEECIPZOEQACNC-DMTCNVIQSA-N.
What is the Canonical SMILES of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The Canonical SMILES is CC1C(NCS1)C(=O)N.
How many hydrogen bond donor counts are there in 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
There are 2 hydrogen bond donor counts.
What is the exact mass of 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
The exact mass is 146.05138412 g/mol.
How many defined atom stereocenter counts are there in 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI)?
There are 2 defined atom stereocenter counts.
Is 4-Thiazolidinecarboxamide,5-methyl-, (4R-trans)-(9CI) a canonicalized compound?
Yes, the compound is canonicalized.