What is the molecular formula of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The molecular formula is C4H5N5O2S.
What is the molecular weight of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The molecular weight is 187.18 g/mol.
What is the IUPAC name of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The IUPAC name is 4,6-diamino-5-nitro-1H-pyrimidine-2-thione.
What is the InChI of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The InChI is InChI=1S/C4H5N5O2S/c5-2-1(9(10)11)3(6)8-4(12)7-2/h(H5,5,6,7,8,12).
What is the InChiKey of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The InChiKey is FIKISJBYQXVMSK-UHFFFAOYSA-N.
What is the Canonical SMILES of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The Canonical SMILES is C1(=C(NC(=S)N=C1N)N)[N+](=O)[O-].
What is the CAS number of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine?
The CAS number is 98019-84-2.
What is the molecular weight of 4,6-Diamino-5-Nitro-2-Thiolpyrimidine according to PubChem?
The molecular weight is 187.18 g/mol.
How many hydrogen bond donor counts does 4,6-Diamino-5-Nitro-2-Thiolpyrimidine have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4,6-Diamino-5-Nitro-2-Thiolpyrimidine have?
It has 4 hydrogen bond acceptor counts.