98358-64-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Amino-4-chloro-benzenesulfonic acid is C6H6ClNO3S.
The molecular weight of 3-Amino-4-chloro-benzenesulfonic acid is 207.64 g/mol.
The IUPAC name of 3-Amino-4-chloro-benzenesulfonic acid is 3-amino-4-chlorobenzenesulfonic acid.
The InChI of 3-Amino-4-chloro-benzenesulfonic acid is InChI=1S/C6H6ClNO3S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,8H2,(H,9,10,11).
The InChIKey of 3-Amino-4-chloro-benzenesulfonic acid is XJQRCFRVWZHIPN-UHFFFAOYSA-N.
The canonical SMILES of 3-Amino-4-chloro-benzenesulfonic acid is C1=CC(=C(C=C1S(=O)(=O)O)N)Cl.
The CAS number of 3-Amino-4-chloro-benzenesulfonic acid is 98-36-2.
The hydrogen bond donor count of 3-Amino-4-chloro-benzenesulfonic acid is 2.
The topological polar surface area of 3-Amino-4-chloro-benzenesulfonic acid is 88.82.