What is the molecular formula of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The molecular formula is C13H20ClN3O.
What is the molecular weight of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The molecular weight is 269.77 g/mol.
When was 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride created?
It was created on August 8, 2005.
What is the IUPAC name of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The IUPAC name is 4-(4-methylanilino)piperidine-4-carboxamide;hydrochloride.
What is the Canonical SMILES representation of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The Canonical SMILES is CC1=CC=C(C=C1)NC2(CCNCC2)C(=O)N.Cl.
What is the CAS number of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The CAS number is 97808-01-0.
How many hydrogen bond donor counts does 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride have?
It has 4 hydrogen bond donor counts.
What is the topological polar surface area of 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride?
The topological polar surface area is 67.2 Å2.
Is 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.
How many covalently-bonded unit counts does 4-(p-Tolylamino)piperidine-4-carboxamide monohydrochloride have?
It has 2 covalently-bonded unit counts.