What is the molecular formula of 3-Chloro-6-methylpyridazinium chloride?
The molecular formula is C5H6Cl2N2.
When was 3-Chloro-6-methylpyridazinium chloride created and modified according to PubChem?
It was created on 2007-07-11 and modified on 2023-12-30.
What is the IUPAC name of 3-Chloro-6-methylpyridazinium chloride?
The IUPAC name is 6-chloro-3-methylpyridazin-1-ium;chloride.
What is the InChI of 3-Chloro-6-methylpyridazinium chloride?
InChI=1S/C5H5ClN2.ClH/c1-4-2-3-5(6)8-7-4;/h2-3H,1H3;1H.
What is the InChIKey of 3-Chloro-6-methylpyridazinium chloride?
The InChIKey is AOMHCMMXWAUZSX-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Chloro-6-methylpyridazinium chloride?
The Canonical SMILES is CC1=N[NH+]=C(C=C1)Cl.[Cl-].
What is the CAS number of 3-Chloro-6-methylpyridazinium chloride?
The CAS number is 97721-79-4.
How many hydrogen bond donor counts are there in 3-Chloro-6-methylpyridazinium chloride?
There is 1 hydrogen bond donor count.
What is the exact mass of 3-Chloro-6-methylpyridazinium chloride?
The exact mass is 163.9908036 g/mol.
Is 3-Chloro-6-methylpyridazinium chloride considered as a canonicalized compound?
Yes, it is considered a canonicalized compound according to PubChem.