CAS
97635-38-6 Purity
---
97635-38-6 Purity
---
Inquiry Basket
2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate
CAS
97635-43-3
Catalog Number
ACM97635433
Category
Other Products
Molecular Formula
C14H18Cl2O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The molecular formula of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is C14H18Cl2O3.
What is the molecular weight of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The molecular weight of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is 305.2 g/mol.
What is the IUPAC name of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The IUPAC name of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is 2-methylbutyl 2-(2,4-dichlorophenoxy)propanoate.
What is the InChI of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The InChI of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is InChI=1S/C14H18Cl2O3/c1-4-9(2)8-18-14(17)10(3)19-13-6-5-11(15)7-12(13)16/h5-7,9-10H,4,8H2,1-3H3.
What is the InChIKey of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The InChIKey of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is IFRYPSDRUFLKRK-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The Canonical SMILES of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is CCC(C)COC(=O)C(C)OC1=C(C=C(C=C1)Cl)Cl.
What is the CAS number of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The CAS number of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is 97635-43-3.
What is the XLogP3 value of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate?
The XLogP3 value of 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate is 5.4.
How many hydrogen bond acceptors does 2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate have?
2-Methylbutyl 2-(2,4-dichlorophenoxy)propionate has 3 hydrogen bond acceptors.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
