What is the molecular formula of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate)?
The molecular formula is C21H40O5.
When was 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate first created in PubChem?
It was first created on August 20, 2009.
What is the IUPAC Name of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate?
The IUPAC Name is [2-hydroxy-3-(3,5,5-trimethylhexanoyloxy)propyl] 3,5,5-trimethylhexanoate.
What is the Canonical SMILES representation of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate?
The Canonical SMILES is CC(CC(=O)OCC(COC(=O)CC(C)CC(C)(C)C)O)CC(C)(C)C.
How many hydrogen bond donor counts does 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate?
The XLogP3-AA value is 5.4.
What is the formal charge of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate?
The formal charge is 0.
How many rotatable bond counts does 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate have?
It has 14 rotatable bond counts.
What is the topological polar surface area of 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate?
The topological polar surface area is 72.8 Ų.
Is 2-Hydroxypropane-1,3-diyl bis(3,5,5-trimethylhexanoate a canonicalized compound?
Yes, it is a canonicalized compound in PubChem.