What is the molecular formula of Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
The molecular formula is C6H6N5NaO.
What is the molecular weight of Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
The molecular weight is 187.13 g/mol.
When was Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate created?
It was created on 2009-08-20.
What are some synonyms for Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
Some synonyms include EINECS 306-578-3, 97337-84-3, and SODIUM 2-AMINO-6-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-5-OLATE.
What is the Canonical SMILES representation of Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
The Canonical SMILES is CC1=CN2C(=NC(=N2)N)N=C1[O-].[Na+].
What is the InChIKey for Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
The InChIKey is KHXVGFQOOMZVHA-UHFFFAOYSA-M.
How many hydrogen bond acceptor counts does Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate have?
It has 5 hydrogen bond acceptor counts.
Is Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate a canonicalized compound?
Yes, it is a canonicalized compound.
What is the topological polar surface area of Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate?
The topological polar surface area is 92.2 Ų.
How many covalently-bonded unit counts does Sodium 2-amino-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-olate have?
It has 2 covalently-bonded unit counts.