What is the molecular formula of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The molecular formula is C20H23N3.
What is the molecular weight of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The molecular weight is 305.4 g/mol.
What is the IUPAC name of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The IUPAC name is 1-benzyl-4-(4-methylanilino)piperidine-4-carbonitrile.
What is the InChI of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The InChI is InChI=1S/C20H23N3/c1-17-7-9-19(10-8-17)22-20(16-21)11-13-23(14-12-20)15-18-5-3-2-4-6-18/h2-10,22H,11-15H2,1H3.
What is the InChIKey of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The InChIKey is OIDUIUJRLUPBPH-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The canonical SMILES is CC1=CC=C(C=C1)NC2(CCN(CC2)CC3=CC=CC=C3)C#N.
What is the CAS number of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The CAS number is 972-19-0.
What is the European Community (EC) Number of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The European Community (EC) Number is 213-544-0.
What is the ChEMBL ID of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The ChEMBL ID is CHEMBL1906614.
What is the XLogP3-AA value of 1-Benzyl-4-(p-toluidino)piperidine-4-carbonitrile?
The XLogP3-AA value is 3.9.