97105-00-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C14H21ClN2O2.
Some synonyms include CRL 41254, N-(3-(2-((1-Methylethyl)amino)-1-oxopropyl)phenyl)acetamide monohydrochloride.
It was created on August 8, 2005.
The IUPAC name is N-[3-[2-(propan-2-ylamino)propanoyl]phenyl]acetamide hydrochloride.
The molecular weight is 284.78 g/mol.
The Canonical SMILES is CC(C)NC(C)C(=O)C1=CC(=CC=C1)NC(=O)C.Cl.
There are 3 hydrogen bond donor counts.
The exact mass is 284.1291556 g/mol.
There are 5 rotatable bond counts.
Yes, the compound is canonicalized.