What is the molecular formula of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The molecular formula is C8H6ClNO.
What is the molecular weight of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The molecular weight is 167.59 g/mol.
What is the IUPAC name of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The IUPAC name is (2R)-2-(4-chlorophenyl)-2-hydroxyacetonitrile.
What is the InChI of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The InChI is InChI=1S/C8H6ClNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4,8,11H/t8-/m0/s1.
What is the InChIKey of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The InChIKey is LSDSHEPNJSMUTI-QMMMGPOBSA-N.
What is the canonical SMILES of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The canonical SMILES is C1=CC(=CC=C1C(C#N)O)Cl.
What is the isomeric SMILES of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The isomeric SMILES is C1=CC(=CC=C1[C@H](C#N)O)Cl.
What is the CAS number of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The CAS number is 97070-79-6.
What is the European Community (EC) number of Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)-?
The European Community (EC) number is 624-601-8.
Is Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)- a covalently-bonded unit?
Yes, Benzeneacetonitrile,4-chloro-a-hydroxy-, (aR)- is a covalently-bonded unit.