What is the molecular formula of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The molecular formula is C6H5Cl5O2.
What is the PubChem CID of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The PubChem CID is 611641.
What is the IUPAC name of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The IUPAC name is methyl 2,4,4-trichloro-3-(dichloromethyl)but-2-enoate.
What is the InChIKey of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The InChIKey is VEPUWSGAJQCMRY-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The canonical SMILES is COC(=O)C(=C(C(Cl)Cl)C(Cl)Cl).
What is the molecular weight of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The molecular weight is 286.4 g/mol.
What is the XLogP3-AA value of 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester?
The XLogP3-AA value is 3.9.
How many hydrogen bond donor counts does 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,4,4-Trichloro-3-(dichloromethyl)crotonic acid methyl ester have?
It has 4 rotatable bond counts.