CAS
97050-36-7 Purity
---
97050-36-7 Purity
---
Inquiry Basket
3-(Piperidinomethyl)thiazolidine-2-thione
CAS
97054-47-2
Catalog Number
ACM97054472
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H16N2S2.
What is the molecular weight of the compound?
The molecular weight of the compound is 216.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-(piperidin-1-ylmethyl)-1,3-thiazolidine-2-thione.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H16N2S2/c12-9-11(6-7-13-9)8-10-4-2-1-3-5-10/h1-8H2.
What is the InChIKey of the compound?
The InChIKey of the compound is UZFFPVYUJRRFCF-UHFFFAOYSA-N.
What is the canonical SMILES notation of the compound?
The canonical SMILES notation of the compound is C1CCN(CC1)CN2CCSC2=S.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Recommended Products
CAS
97055-33-9 Purity
96%
97055-33-9 Purity
96%
