What is the molecular formula of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The molecular formula is C15H28O2.
What is the molecular weight of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The molecular weight is 240.38 g/mol.
What is the IUPAC name of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The IUPAC name is (2-methyl-6-methylideneoctan-2-yl) 3-methylbutanoate.
What is the InChI of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The InChI is InChI=1S/C15H28O2/c1-7-13(4)9-8-10-15(5,6)17-14(16)11-12(2)3/h12H,4,7-11H2,1-3,5-6H3.
What is the InChIKey of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The InChIKey is YOUZPPOBZXKXHX-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
The Canonical SMILES is CCC(=C)CCCC(C)(C)OC(=O)CC(C)C.
How many hydrogen bond donor counts does 1,1-Dimethyl-5-methyleneheptyl isovalerate have?
It has 0 hydrogen bond donor counts.
What is the hydrogen bond acceptor count of 1,1-Dimethyl-5-methyleneheptyl isovalerate?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 1,1-Dimethyl-5-methyleneheptyl isovalerate have?
It has 9 rotatable bond counts.
Is 1,1-Dimethyl-5-methyleneheptyl isovalerate a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.