What is the molecular formula of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The molecular formula of 4-Amino-3,5-dibromobenzene-1-carbohydrazide is C7H7Br2N3O.
When was 4-Amino-3,5-dibromobenzene-1-carbohydrazide created and modified in PubChem?
It was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The IUPAC name is 4-amino-3,5-dibromobenzohydrazide.
What is the Canonical SMILES representation of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The Canonical SMILES representation is C1=C(C=C(C(=C1Br)N)Br)C(=O)NN.
How many hydrogen bond donor counts does 4-Amino-3,5-dibromobenzene-1-carbohydrazide have?
It has 3 hydrogen bond donor counts.
What is the exact mass of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The exact mass is 308.89354 g/mol.
What is the heavy atom count of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The heavy atom count is 13.
Does 4-Amino-3,5-dibromobenzene-1-carbohydrazide have any defined atom stereocenter count?
No, it has 0 defined atom stereocenter count.
What is the topological polar surface area of 4-Amino-3,5-dibromobenzene-1-carbohydrazide?
The topological polar surface area is 81.1 Ų.
Is 4-Amino-3,5-dibromobenzene-1-carbohydrazide considered canonicalized in PubChem?
Yes, it is considered canonicalized in PubChem.