96446-12-7 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of 2,3-Dimethoxy-5-sulfobenzoic acid is C9H10O7S.
2,3-Dimethoxy-5-sulfobenzoic acid was created in PubChem on August 8, 2005.
The IUPAC name of 2,3-Dimethoxy-5-sulfobenzoic acid is 2,3-dimethoxy-5-sulfobenzoic acid.
The Canonical SMILES of 2,3-Dimethoxy-5-sulfobenzoic acid is COC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)O.
The InChIKey of 2,3-Dimethoxy-5-sulfobenzoic acid is ARYSOZFIGZXBFU-UHFFFAOYSA-N.
The molecular weight of 2,3-Dimethoxy-5-sulfobenzoic acid is 262.24 g/mol.
2,3-Dimethoxy-5-sulfobenzoic acid has 2 hydrogen bond donor counts.
The topological polar surface area of 2,3-Dimethoxy-5-sulfobenzoic acid is 119 Ų.
Yes, 2,3-Dimethoxy-5-sulfobenzoic acid is a canonicalized compound.
2,3-Dimethoxy-5-sulfobenzoic acid has 1 covalently-bonded unit.