96302-71-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 1-benzyl-4-(butylamino)piperidine-4-carbonitrile.
The molecular weight of the compound is 271.4 g/mol.
The InChI key of the compound is UUBVCUBWRBXOGL-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCCCNC1(CCN(CC1)CC2=CC=CC=C2)C#N.
The CAS number of the compound is 963-08-6.
The European Community (EC) number of the compound is 213-513-1.
The ChEMBL ID of the compound is CHEMBL1721211.
The DSSTox Substance ID of the compound is DTXSID30242193.
The Nikkaji Number of the compound is J298.568C.
The Monoisotopic Mass of the compound is 271.204847810 g/mol.