96236-05-4 Purity
98 atom % D
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C5H4BrNO2.
The molecular weight of the compound is 189.99 g/mol.
The IUPAC Name of the compound is 3-bromo-4-hydroxy-1H-pyridin-2-one.
The InChI of the compound is InChI=1S/C5H4BrNO2/c6-4-3(8)1-2-7-5(4)9/h1-2H,(H2,7,8,9).
The InChIKey of the compound is AZYBXXIHALNBIX-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CNC(=O)C(=C1O)Br.
The XLogP3-AA value of the compound is 0.5.
The compound has 2 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor count.
The compound has 0 rotatable bond count.