96232-39-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H4Br2O3S.
The molecular weight of the compound is 315.97 g/mol.
The IUPAC name of the compound is methyl 4,5-dibromo-3-hydroxythiophene-2-carboxylate.
The InChI of the compound is InChI=1S/C6H4Br2O3S/c1-11-6(10)4-3(9)2(7)5(8)12-4/h9H,1H3.
The InChIKey of the compound is BRIPHJFDXWRHAV-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)C1=C(C(=C(S1)Br)Br)O.
The CAS number of the compound is 96232-71-2.
The XLogP3-AA value of the compound is 3.7.
The compound has 1 hydrogen bond donor count.
Yes, the compound is canonicalized.