What is the molecular formula of N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester?
The molecular formula is C10H14N2O6.
When was N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester created in PubChem?
It was created on April 28, 2008.
What is the molecular weight of N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester?
The molecular weight is 258.23 g/mol.
How many hydrogen bond donor counts does N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester have?
It has 0 hydrogen bond donor count.
What is the topological polar surface area of N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester?
The topological polar surface area is 94.5 Å2.
How many rotatable bond counts does N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester have?
It has 7 rotatable bond counts.
What is the exact mass of N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester?
The exact mass is 258.08518617 g/mol.
Does N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester have any defined bond stereocenter count?
Yes, it has 1 defined bond stereocenter count.
What is the canonical SMILES representation of N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester?
The canonical SMILES is CCOC(=NOCC(=O)ON1C(=O)CCC1=O)C.
Is N-(1-Ethoxyethylidene)-2-aminooxyacetic acid N-hydroxysuccinimidyl ester considered a canonicalized compound in PubChem?
Yes, it is considered a canonicalized compound.