96021-99-7 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of 2,6-bis-(difluoromethyl)benzoic acid is C9H6F4O2.
The molecular weight of 2,6-bis-(difluoromethyl)benzoic acid is 222.14 g/mol.
The IUPAC name of 2,6-bis-(difluoromethyl)benzoic acid is 2,6-bis(difluoromethyl)benzoic acid.
The InChI of 2,6-bis-(difluoromethyl)benzoic acid is InChI=1S/C9H6F4O2/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h1-3,7-8H,(H,14,15).
The InChIKey of 2,6-bis-(difluoromethyl)benzoic acid is CGDQXHCGTDBEBL-UHFFFAOYSA-N.
The canonical SMILES of 2,6-bis-(difluoromethyl)benzoic acid is C1=CC(=C(C(=C1)C(F)F)C(=O)O)C(F)F.
The XLogP3-AA value of 2,6-bis-(difluoromethyl)benzoic acid is 2.7.
2,6-bis-(difluoromethyl)benzoic acid has 1 hydrogen bond donor count.
2,6-bis-(difluoromethyl)benzoic acid has 6 hydrogen bond acceptor counts.
2,6-bis-(difluoromethyl)benzoic acid has 3 rotatable bond counts.