CAS
960198-55-4 Purity
---
960198-55-4 Purity
---
Shopping basket
2-(2,5-Difluoro-phenyl)-pyrimidine-5-carboxylic acid amide
CAS
960198-58-7
Catalog Number
ACM960198587
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-(2,5-Difluoro-phenyl)-pyrimidine-5-carboxylic acid amide
What is the molecular formula of the compound?
The molecular formula of the compound is C11H7F2N3O.
When was the compound created and last modified?
The compound was created on 2010-03-29 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(2,5-difluorophenyl)pyrimidine-5-carboxamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 235.19 g/mol.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation of the compound is C1=CC(=C(C=C1F)C2=NC=C(C=N2)C(=O)N)F.
What is the InChIKey of the compound?
The InChIKey of the compound is VZJXEVZUPAZURI-UHFFFAOYSA-N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 68.9 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
960198-59-8 Purity
---
960198-59-8 Purity
---
