What is the molecular formula of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The molecular formula is C11H12N2O.
What is the PubChem CID of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The PubChem CID is 66521755.
What is the IUPAC name of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The IUPAC name is 2-phenyl-2,6-diazaspiro[3.3]heptan-3-one.
What is the InChI of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The InChI is InChI=1S/C11H12N2O/c14-10-11(6-12-7-11)8-13(10)9-4-2-1-3-5-9/h1-5,12H,6-8H2.
What is the InChIKey of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The InChIKey is JGOYKNYAYFJVST-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The canonical SMILES is C1C2(CN1)CN(C2=O)C3=CC=CC=C3.
What is the CAS number of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The CAS number is 960079-47-4.
What is the molecular weight of 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
The molecular weight is 188.23 g/mol.
How many hydrogen bond donor counts are there in 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in 2-Phenyl-2,6-diazaspiro[3.3]heptan-1-one?
There are 2 hydrogen bond acceptor counts.