What is the molecular formula of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The molecular formula is C10H14O4S.
What are the synonyms for Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The synonyms are 5-Hydroxy-p-cymene-2-sulphonic acid, Thymolsulfonic acid, 6-Thymolsulfonic acid.
What is the molecular weight of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The molecular weight is 230.28 g/mol.
What is the IUPAC name of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The IUPAC name is 4-hydroxy-2-methyl-5-propan-2-ylbenzenesulfonic acid.
What is the InChI of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The InChI is InChI=1S/C10H14O4S/c1-6(2)8-5-10(15(12,13)14)7(3)4-9(8)11/h4-6,11H,1-3H3,(H,12,13,14).
What is the InChIKey of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The InChIKey is LYWNNXMNOSKLHY-UHFFFAOYSA-N.
What is the canonical SMILES of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The canonical SMILES is CC1=CC(=C(C=C1S(=O)(=O)O)C(C)C)O.
What is the CAS number of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The CAS number is 96-68-4.
What is the European Community (EC) number of Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)?
The European Community (EC) number is 202-524-7.
Is Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl) a canonicalized compound?
Yes, it is a canonicalized compound.