CAS
96159-85-2 Purity
---
96159-85-2 Purity
---
Inquiry Basket
3-Amino-2-methylpropiononitrile
CAS
96-16-2
Catalog Number
ACM96162
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Amino-2-methylpropiononitrile?
The molecular formula of 3-Amino-2-methylpropiononitrile is C4H8N2.
What is the molecular weight of 3-Amino-2-methylpropiononitrile?
The molecular weight of 3-Amino-2-methylpropiononitrile is 84.12 g/mol.
What is the IUPAC name of 3-Amino-2-methylpropiononitrile?
The IUPAC name of 3-Amino-2-methylpropiononitrile is 3-amino-2-methylpropanenitrile.
What is the InChI of 3-Amino-2-methylpropiononitrile?
The InChI of 3-Amino-2-methylpropiononitrile is InChI=1S/C4H8N2/c1-4(2-5)3-6/h4H,2,5H2,1H3.
What is the InChIKey of 3-Amino-2-methylpropiononitrile?
The InChIKey of 3-Amino-2-methylpropiononitrile is GDIMNXJSMJSDSB-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Amino-2-methylpropiononitrile?
The canonical SMILES of 3-Amino-2-methylpropiononitrile is CC(CN)C#N.
What is the CAS number of 3-Amino-2-methylpropiononitrile?
The CAS number of 3-Amino-2-methylpropiononitrile is 96-16-2.
How many hydrogen bond donor counts does 3-Amino-2-methylpropiononitrile have?
3-Amino-2-methylpropiononitrile has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Amino-2-methylpropiononitrile have?
3-Amino-2-methylpropiononitrile has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Amino-2-methylpropiononitrile have?
3-Amino-2-methylpropiononitrile has 1 rotatable bond count.
Recommended Products
CAS
96160-01-9 Purity
---
96160-01-9 Purity
---
