What is the molecular weight of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The molecular weight is 299.29 g/mol.
What is the IUPAC name of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The IUPAC name is (2R,3R)-3-(3-fluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
What is the InChIKey of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The InChIKey is LOILSZBYEOKFTC-GHMZBOCLSA-N.
What is the Canonical SMILES of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The Canonical SMILES is CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)F)C(C(=O)O)O.
How many hydrogen bond donor counts are there in N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
There are 3 hydrogen bond donor counts.
What is the topological polar surface area of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The topological polar surface area is 95.9 Ų.
Is N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
How many defined atom stereocenters are there in N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
There are 2 defined atom stereocenters.
What is the XLogP3-AA value of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The XLogP3-AA value is 1.5.
What is the exact mass of N-Boc-(2R,3R)-3-Amino-3-(3-fluorophenyl)-2-hydroxypropanoic acid?
The exact mass is 299.11690084 g/mol.