What is the molecular formula of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The molecular formula is C11H20Si.
What is the molecular weight of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The molecular weight is 180.36 g/mol.
What is the IUPAC name of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The IUPAC name is trimethyl-(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)silane.
What is the InChI of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The InChI is InChI=1S/C11H20Si/c1-9-10(12(4,5)6)7-8-11(9,2)3/h7-8H,1-6H3.
What is the InChIKey of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The InChIKey is PSQIUDSCVQRSRN-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The canonical SMILES is CC1=C(C=CC1(C)C)[Si](C)(C)C.
How many hydrogen bond donor counts are there in 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
There are 0 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
There is 1 rotatable bond count.
What is the topological polar surface area of 1,3-Cyclopentadiene, 1,5,5-trimethyl-2-(trimethylsilyl)?
The topological polar surface area is 0-2.