95926-99-1 Purity
99 atom % D
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C4H10O.
The molecular weight is 77.14 g/mol.
The IUPAC name is 3,3,3-trideuterio-2-methylpropan-1-ol.
The InChI is InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3/i1D3.
The InChIKey is ZXEKIIBDNHEJCQ-FIBGUPNXSA-N.
The canonical SMILES is CC(C)CO.
The computed properties include molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound canonicalization.
The XLogP3 value is 0.8.
It has 1 hydrogen bond donor count.
Yes, it is a canonicalized compound.