CAS
959240-31-4 Purity
---
959240-31-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C8H6ClN3O.
It was created on May 28, 2009.
The IUPAC name is 5-(2-chloropyridin-4-yl)-3-methyl-1,2,4-oxadiazole.
The canonical SMILES is CC1=NOC(=N1)C2=CC(=NC=C2)Cl.
The molecular weight is 195.60 g/mol.
There are 0 hydrogen bond donor counts.
The hydrogen bond acceptor count is 4.
The topological polar surface area is 51.8 Ų.
There are 13 heavy atoms.
Yes, the compound is canonicalized.