What is the molecular formula of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The molecular formula is C9H12Cl2N2.
What is the molecular weight of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The molecular weight is 219.11 g/mol.
What is the IUPAC name of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The IUPAC name is 3,5-dichloro-N-ethyl-2,6-dimethylpyridin-4-amine.
What is the InChIKey of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The InChIKey is LGEGEQGAVXXRNA-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The Canonical SMILES is CCNC1=C(C(=NC(=C1Cl)C)C)Cl.
How many hydrogen bond donor counts does 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The XLogP3-AA value is 3.3.
What is the heavy atom count of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The heavy atom count is 13.
Is 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl considered canonicalized?
Yes, it is canonicalized.
What is the topological polar surface area of 4-Pyridinamine, 3,5-dichloro-N-ethyl-2,6-dimethyl?
The topological polar surface area is 24.9 Ų.