What is the molecular formula of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The molecular formula is C9H7BrN2O.
What is the molecular weight of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The molecular weight is 239.07 g/mol.
What is the IUPAC name of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The IUPAC name is 4-bromo-1-methylbenzimidazole-2-carbaldehyde.
What is the InChI code of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The InChI code is InChI=1S/C9H7BrN2O/c1-12-7-4-2-3-6(10)9(7)11-8(12)5-13/h2-5H,1H3.
What is the InChIKey of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The InChIKey is ASNYHGBIYZZGDU-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The Canonical SMILES is CN1C2=C(C(=CC=C2)Br)N=C1C=O.
What is the topological polar surface area of 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
The topological polar surface area is 34.9 Ų.
How many hydrogen bond acceptor counts are there in 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde?
There are 2 hydrogen bond acceptor counts.
Is 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde canonicalized?
Yes, the compound is canonicalized.
When was 4-Bromo-1-methyl-1H-benzimidazole-2-carboxaldehyde created and last modified in PubChem?
It was created on 2009-05-30 and last modified on 2023-12-30.