What is the molecular formula of Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
The molecular formula is C44H76O4Sn.
When was Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane created and last modified in PubChem?
It was created on 2009-08-20 and last modified on 2023-12-30.
What is the IUPAC Name of Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
The IUPAC Name is [dibutyl-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxystannyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
What is the Canonical SMILES of Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
The Canonical SMILES is CCCC[Sn](CCCC)(OC(=O)CCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCC=CCC.
How many Hydrogen Bond Acceptor Count does Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane have?
It has 4 Hydrogen Bond Acceptor Count.
What is the Exact Mass of Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
The Exact Mass is 788.476563 g/mol.
What is the Topological Polar Surface Area of Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
The Topological Polar Surface Area is 52.6 2.
How many Heavy Atom Count does Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane have?
It has 49 Heavy Atom Count.
How many Defined Bond Stereocenter Count does Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane have?
It has 6 Defined Bond Stereocenter Count.
Is the Compound Is Canonicalized for Dibutylbis(octadeca-9(Z),12(Z),15(Z)-trienoyloxy)stannane?
Yes, the Compound Is Canonicalized.