What is the molecular formula of Allylbis(2-hydroxypropyl)oleylammonium chloride?
The molecular formula is C27H54ClNO2.
When was Allylbis(2-hydroxypropyl)oleylammonium chloride created and modified?
It was created on 2007-12-05 and modified on 2023-12-30.
What is the IUPAC name of Allylbis(2-hydroxypropyl)oleylammonium chloride?
The IUPAC name is bis(2-hydroxypropyl)-[(Z)-octadec-9-enyl]-prop-2-enylazanium;chloride.
What is the InChI key of Allylbis(2-hydroxypropyl)oleylammonium chloride?
The InChI key is WSUXIQNBHBCBRI-HPWRNOGASA-M.
What is the canonical SMILES representation of Allylbis(2-hydroxypropyl)oleylammonium chloride?
The canonical SMILES representation is CCCCCCCCC=CCCCCCCCC[N+](CC=C)(CC(C)O)CC(C)O.[Cl-].
What is the European Community Number for Allylbis(2-hydroxypropyl)oleylammonium chloride?
The European Community Number is 306-043-4.
What is the hydrogen bond donor count for Allylbis(2-hydroxypropyl)oleylammonium chloride?
There are 2 hydrogen bond donors.
What is the hydrogen bond acceptor count for Allylbis(2-hydroxypropyl)oleylammonium chloride?
There are 3 hydrogen bond acceptors.
What is the rotatable bond count for Allylbis(2-hydroxypropyl)oleylammonium chloride?
There are 22 rotatable bonds.
Is the compound canonicalized?
Yes, the compound is canonicalized.