What is the molecular formula of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The molecular formula is C6H5ClNNaO4S.
What is the molecular weight of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The molecular weight is 245.62 g/mol.
What are some synonyms for Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
Some synonyms include Sodium 3-amino-5-chloro-2-hydroxybenzenesulphonate and SODIUM 3-AMINO-5-CHLORO-2-HYDROXYBENZENESULFONATE.
What is the IUPAC name of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The IUPAC name is sodium;3-amino-5-chloro-2-hydroxybenzenesulfonate.
What is the InChI key of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The InChI key is BLIWWSFAMCKJON-UHFFFAOYSA-M.
What is the canonical SMILES representation of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The canonical SMILES is C1=C(C=C(C(=C1N)O)S(=O)(=O)[O-])Cl.[Na+].
How many hydrogen bond donor counts are present in Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
There are 2 hydrogen bond donor counts.
What is the exact mass of Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
The exact mass is 244.9525508 g/mol.
How many heavy atoms are present in Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate?
There are 14 heavy atoms.
Is Sodium 3-amino-5-chloro-2-hydroxybenzenesulfonate a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.