What is the molecular formula of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The molecular formula is C16H28N2O6.
What is the molecular weight of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The molecular weight is 344.40 g/mol.
When was (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester created?
It was created on July 12, 2012.
When was (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The IUPAC name is 1-O,4-O-ditert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate.
What is the InChI of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The InChI is InChI=1S/C16H28N2O6/c1-15(2,3)23-13(20)17-8-9-18(11(10-17)12(19)22-7)14(21)24-16(4,5)6/h11H,8-10H2,1-7H3/t11-/m0/s1.
What is the InChIKey of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The InChIKey is QKNSGUCCNZBAAJ-NSHDSACASA-N.
What is the canonical SMILES of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The canonical SMILES is CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)OC)C(=O)OC(C)(C)C.
What is the CAS number of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The CAS number is 958635-19-3.
What is the XLogP3-AA value of (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester?
The XLogP3-AA value is 1.7.