CAS
958451-71-3 Purity
---
958451-71-3 Purity
---
Inquiry Basket
3-difluoromethoxy-4-methyl-benzeneboronic acid
CAS
958451-74-6
Catalog Number
ACM958451746
Category
Other Products
Molecular Weight
201.9630664
Molecular Formula
C8H9BF2O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
3-difluoromethoxy-4-methyl-benzeneboronic acid
What is the molecular formula of the compound?
The molecular formula of the compound is C8H9BF2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 201.97 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-(difluoromethoxy)-4-methylphenyl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9BF2O3/c1-5-2-3-6(9(12)13)4-7(5)14-8(10)11/h2-4,8,12-13H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is WVVOHJNTNLIDIK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CC(=C(C=C1)C)OC(F)F)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 958451-74-6.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID20669678.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor count.
Recommended Products
CAS
958451-77-9 Purity
---
958451-77-9 Purity
---
