CAS
95792-85-1 Purity
---
95792-85-1 Purity
---
![11,12-Bis[N-methyl-1H-benzimidazolium-3-methylene]-9,10-dihydro-9,10-ethanoanthracene bis(trifluoromethanesulfonate)](https://resource.alfa-chemistry.com/structure/958004-03-0.gif)
Inquiry Basket
4-Penten-2-ol,2-methyl-3-(trimethylsilyl)-
CAS
957997-63-6
Catalog Number
ACM957997636
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H20OSi.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-methyl-3-trimethylsilylpent-4-en-2-ol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H20OSi/c1-7-8(9(2,3)10)11(4,5)6/h7-8,10H,1H2,2-6H3.
What is the InChIKey of the compound?
The InChIKey of the compound is OLCDLNXQAZLJAH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)(C(C=C)[Si](C)(C)C)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 172.34 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 1 hydrogen bond acceptor count.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 20.2Ų.
Recommended Products
