957346-47-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12O4S.
The synonyms for the compound are 2-(3,4-DIMETHOXYPHENYLTHIO)ACETIC ACID, 95735-63-0, 2-((3,4-Dimethoxyphenyl)thio)acetic acid, and (3,4-Dimethoxyphenylthio)acetic acid.
The compound was created on July 8, 2005.
The IUPAC name of the compound is 2-(3,4-dimethoxyphenyl)sulfanylacetic acid.
The InChI code of the compound is InChI=1S/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12).
The InChIKey of the compound is ANVXBTSSFGHHBD-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=C(C=C(C=C1)SCC(=O)O)OC.
The molecular weight of the compound is 228.27 g/mol.
The XLogP3 value of the compound is 2.2.
Yes, the compound has a hydrogen bond donor count of 1 and a hydrogen bond acceptor count of 5.