What is the molecular formula of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The molecular formula is C10H7Cl2NO2.
When was the structure of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol created and last modified?
The structure was created on 2009-05-28 and last modified on 2023-12-30.
What is the IUPAC Name of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The IUPAC Name is [5-(2,4-dichlorophenyl)-1,3-oxazol-4-yl]methanol.
What is the InChIKey of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The InChIKey is XWBSXYDCPBBFEK-UHFFFAOYSA-N.
What is the Canonical SMILES of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The Canonical SMILES is C1=CC(=C(C=C1Cl)Cl)C2=C(N=CO2)CO.
What is the exact mass of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The exact mass is 242.9853839 g/mol.
How many hydrogen bond donor counts does (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
The topological polar surface area is 46.3 Ų.
How many rotatable bond counts are in (5-(2,4-Dichlorophenyl)oxazole-4-yl)methanol?
It has 2 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.