What is the molecular formula of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The molecular formula is C7H7BBrFO3.
When was 6-Bromo-3-fluoro-2-methoxyphenylboronic acid created and last modified?
It was created on January 26, 2010, and last modified on December 30, 2023.
What is the IUPAC name of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The IUPAC name is (6-bromo-3-fluoro-2-methoxyphenyl)boronic acid.
What is the InChIKey of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The InChIKey is QBCPODUNQONQHF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The canonical SMILES representation is B(C1=C(C=CC(=C1OC)F)Br)(O)O.
What is the exact mass of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The exact mass is 247.96556 g/mol.
How many hydrogen bond donor counts does 6-Bromo-3-fluoro-2-methoxyphenylboronic acid have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 6-Bromo-3-fluoro-2-methoxyphenylboronic acid?
The topological polar surface area is 49.7 Ų.
How many rotatable bond counts does 6-Bromo-3-fluoro-2-methoxyphenylboronic acid have?
It has 2 rotatable bond counts.
Is 6-Bromo-3-fluoro-2-methoxyphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.