What is the molecular formula of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The molecular formula is C10H18ClNO2.
When was ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride created?
It was created on July 21, 2009.
What is the IUPAC name of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The IUPAC name is ethyl (1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylate;hydrochloride.
What is the Canonical SMILES of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The Canonical SMILES is CCOC(=O)C1C2CCC(C2)C1N.Cl.
How many hydrogen bond donor counts does ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride have?
It has 2 hydrogen bond donors.
What is the exact mass of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The exact mass is 219.1026065 g/mol.
What is the topological polar surface area of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The topological polar surface area is 52.3 Ų.
How many defined atom stereocenters does ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride have?
It has 4 defined atom stereocenters.
Is ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
What is the Isotope Atom Count of ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride?
The Isotope Atom Count is 0.