956103-79-0 Purity
98%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C8H13N3O.
The molecular weight of the compound is 167.21 g/mol.
The IUPAC name of the compound is N-[1-(1H-imidazol-5-yl)propan-2-yl]acetamide.
The InChI of the compound is InChI=1S/C8H13N3O/c1-6(11-7(2)12)3-8-4-9-5-10-8/h4-6H,3H2,1-2H3,(H,9,10)(H,11,12).
The InChIKey of the compound is RYZMIBSFRZJAGO-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(CC1=CN=CN1)NC(=O)C.
The XLogP3-AA value of the compound is 0.1.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
[Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |