95596-80-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-fluoro-4-iodo-1H-indole.
The molecular formula of the compound is C8H5FIN.
The molecular weight of the compound is 261.03 g/mol.
The InChI of the compound is InChI=1S/C8H5FIN/c9-6-1-2-7-5(8(6)10)3-4-11-7/h1-4,11H.
The InChIKey of the compound is PZVWMIMJWJJLAW-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=C(C2=C1NC=C2)I)F.
The XLogP3-AA value of the compound is 2.8.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.
The compound has 0 rotatable bond count.